C22H20N4O6S — CID 177165951
(5Z)-5-[(4-nitrophenyl)methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 177165951) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is (5Z)-5-[(4-nitrophenyl)methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-5-[(4-nitrophenyl)methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 177165951 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (5Z)-5-[(4-nitrophenyl)methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | COc1cc(CCc2nc3s/c(=C\c4ccc([N+](=O)[O-])cc4)c(=O)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N4O6S/c1-30-16-10-14(11-17(31-2)20(16)32-3)6-9-19-23-22-25(24-19)21(27)18(33-22)12-13-4-7-15(8-5-13)26(28)29/h4-5,7-8,10-12H,6,9H2,1-3H3/b18-12- |
| InChIKey | JLZYDBPMMGOHLJ-PDGQHHTCSA-N |
| XLogP | 2.42 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|