C26H21Cl2N3O5S — CID 177166022
(5Z)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 177166022) has the molecular formula C26H21Cl2N3O5S and a molecular weight of 558.44 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 177166022 |
| Molecular Formula | C26H21Cl2N3O5S |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | (5Z)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[2-(3,4,5-trimethoxyphenyl)ethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | COc1cc(CCc2nc3s/c(=C\c4ccc(-c5cc(Cl)ccc5Cl)o4)c(=O)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H21Cl2N3O5S/c1-33-20-10-14(11-21(34-2)24(20)35-3)4-9-23-29-26-31(30-23)25(32)22(37-26)13-16-6-8-19(36-16)17-12-15(27)5-7-18(17)28/h5-8,10-13H,4,9H2,1-3H3/b22-13- |
| InChIKey | USBNNFNQBAVMKR-XKZIYDEJSA-N |
| XLogP | 5.08 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |