C23H15Cl2N3O4S — CID 3698895
5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(3,4-dimethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 3698895) has the molecular formula C23H15Cl2N3O4S and a molecular weight of 500.36 g/mol. Its IUPAC name is 5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(3,4-dimethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(3,4-dimethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 3698895 |
| Molecular Formula | C23H15Cl2N3O4S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(3,4-dimethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | COc1ccc(-c2nc3sc(=Cc4ccc(-c5cc(Cl)ccc5Cl)o4)c(=O)n3n2)cc1OC |
| InChI | InChI=1S/C23H15Cl2N3O4S/c1-30-18-7-3-12(9-19(18)31-2)21-26-23-28(27-21)22(29)20(33-23)11-14-5-8-17(32-14)15-10-13(24)4-6-16(15)25/h3-11H,1-2H3 |
| InChIKey | FVNJFEFMZNGGKO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |