C21H9Cl4N3O2S — CID 6527394
(5Z)-2-(2,4-dichlorophenyl)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 6527394) has the molecular formula C21H9Cl4N3O2S and a molecular weight of 509.20 g/mol. Its IUPAC name is (5Z)-2-(2,4-dichlorophenyl)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-2-(2,4-dichlorophenyl)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 6527394 |
| Molecular Formula | C21H9Cl4N3O2S |
| Molecular Weight | 509.20 g/mol |
| Exact Mass | 506.92 |
| IUPAC Name | (5Z)-2-(2,4-dichlorophenyl)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | O=c1/c(=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)sc2nc(-c3ccc(Cl)cc3Cl)nn12 |
| InChI | InChI=1S/C21H9Cl4N3O2S/c22-11-2-4-13(15(24)8-11)19-26-21-28(27-19)20(29)18(31-21)9-12-3-6-17(30-12)10-1-5-14(23)16(25)7-10/h1-9H/b18-9- |
| InChIKey | DMHQDHPWHXWQHY-NVMNQCDNSA-N |
| XLogP | 6.24 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.20 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |