C16H32N4O3 — CID 177167159
N-butyl-2-[methyl-[2-[methyl-[2-[methyl(propan-2-yl)amino]acetyl]amino]acetyl]amino]acetamide (PubChem CID 177167159) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-butyl-2-[methyl-[2-[methyl-[2-[methyl(propan-2-yl)amino]acetyl]amino]acetyl]amino]acetamide.
| Compound Name | N-butyl-2-[methyl-[2-[methyl-[2-[methyl(propan-2-yl)amino]acetyl]amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 177167159 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | N-butyl-2-[methyl-[2-[methyl-[2-[methyl(propan-2-yl)amino]acetyl]amino]acetyl]amino]acetamide |
| SMILES | CCCCNC(=O)CN(C)C(=O)CN(C)C(=O)CN(C)C(C)C |
| InChI | InChI=1S/C16H32N4O3/c1-7-8-9-17-14(21)10-19(5)16(23)12-20(6)15(22)11-18(4)13(2)3/h13H,7-12H2,1-6H3,(H,17,21) |
| InChIKey | YMZJNXHTIGIENZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|