C9H13F3N2 — CID 177168210
2,2,2-trifluoro-N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide (PubChem CID 177168210) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide.
| Compound Name | 2,2,2-trifluoro-N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide |
|---|---|
| PubChem CID | 177168210 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2,2,2-trifluoro-N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide |
| SMILES | C=CC(N/C(=N\C)C(F)(F)F)=C(C)C |
| InChI | InChI=1S/C9H13F3N2/c1-5-7(6(2)3)14-8(13-4)9(10,11)12/h5H,1H2,2-4H3,(H,13,14) |
| InChIKey | ASGDKTCFDBXBDP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|