C9H16N2 — CID 156898302
N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide (PubChem CID 156898302) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide.
| Compound Name | N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide |
|---|---|
| PubChem CID | 156898302 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)ethanimidamide |
| SMILES | C=CC(N/C(C)=N/C)=C(C)C |
| InChI | InChI=1S/C9H16N2/c1-6-9(7(2)3)11-8(4)10-5/h6H,1H2,2-5H3,(H,10,11) |
| InChIKey | PXYDFUWDYNEGDR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|