C11H17NO2S — CID 177169011
thian-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate (PubChem CID 177169011) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is thian-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate.
| Compound Name | thian-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate |
|---|---|
| PubChem CID | 177169011 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | thian-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate |
| SMILES | O=C(OC1CCSCC1)C1C2CNC1C2 |
| InChI | InChI=1S/C11H17NO2S/c13-11(10-7-5-9(10)12-6-7)14-8-1-3-15-4-2-8/h7-10,12H,1-6H2 |
| InChIKey | XZNXGNRXGITMFK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |