About oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate
oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate (PubChem CID 177168977) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate.
Molecular Properties
| Compound Name | oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate |
| PubChem CID | 177168977 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate |
| SMILES | O=C(OC1CCOCC1)C1C2CNC1C2 |
| InChI | InChI=1S/C11H17NO3/c13-11(10-7-5-9(10)12-6-7)15-8-1-3-14-4-2-8/h7-10,12H,1-6H2 |
| InChIKey | RYIMHSQREVBGRN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate?
The IUPAC name of oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate (CID 177168977) is oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate.
What is the SMILES notation for oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate?
The canonical SMILES for oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate is O=C(OC1CCOCC1)C1C2CNC1C2.
What is the InChIKey of oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate?
The InChIKey is RYIMHSQREVBGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c13-11(10-7-5-9(10)12-6-7)15-8-1-3-14-4-2-8/h7-10,12H,1-6H2.
What are the key properties of oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate?
oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate has a molecular weight of 211.26 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 2-azabicyclo[2.1.1]hexane-5-carboxylate is sourced from PubChem (CID 177168977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).