C31H26F2N6O3 — CID 177169158
3-cyano-N-[(2S,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-5-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide (PubChem CID 177169158) has the molecular formula C31H26F2N6O3 and a molecular weight of 568.58 g/mol. Its IUPAC name is 3-cyano-N-[(2S,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-5-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide.
| Compound Name | 3-cyano-N-[(2S,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-5-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 177169158 |
| Molecular Formula | C31H26F2N6O3 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 3-cyano-N-[(2S,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-5-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cnn3c2C(=O)N(c2ccc(C(F)(F)c4ccccc4)cc2)[C@H]2C(C)NC[C@@H]23)cc1C#N |
| InChI | InChI=1S/C31H26F2N6O3/c1-18-27-25(17-35-18)39-28(24(16-36-39)37-29(40)19-8-13-26(42-2)20(14-19)15-34)30(41)38(27)23-11-9-22(10-12-23)31(32,33)21-6-4-3-5-7-21/h3-14,16,18,25,27,35H,17H2,1-2H3,(H,37,40)/t18?,25-,27-/m0/s1 |
| InChIKey | IEYSUDUFZNOOLS-KJKVOVBMSA-N |
| XLogP | 4.72 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |