C33H29F2N7O4 — CID 177169172
3-cyano-N-[(2R,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-4-[2-(methylamino)acetyl]-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide (PubChem CID 177169172) has the molecular formula C33H29F2N7O4 and a molecular weight of 625.64 g/mol. Its IUPAC name is 3-cyano-N-[(2R,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-4-[2-(methylamino)acetyl]-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide.
| Compound Name | 3-cyano-N-[(2R,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-4-[2-(methylamino)acetyl]-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 177169172 |
| Molecular Formula | C33H29F2N7O4 |
| Molecular Weight | 625.64 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | 3-cyano-N-[(2R,6S)-7-[4-[difluoro(phenyl)methyl]phenyl]-4-[2-(methylamino)acetyl]-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-10-yl]-4-methoxybenzamide |
| SMILES | CNCC(=O)N1C[C@@H]2[C@H](C1)N(c1ccc(C(F)(F)c3ccccc3)cc1)C(=O)c1c(NC(=O)c3ccc(OC)c(C#N)c3)cnn12 |
| InChI | InChI=1S/C33H29F2N7O4/c1-37-17-29(43)40-18-26-27(19-40)42-30(25(16-38-42)39-31(44)20-8-13-28(46-2)21(14-20)15-36)32(45)41(26)24-11-9-23(10-12-24)33(34,35)22-6-4-3-5-7-22/h3-14,16,26-27,37H,17-19H2,1-2H3,(H,39,44)/t26-,27+/m0/s1 |
| InChIKey | DDWFLBZSGFWMAR-RRPNLBNLSA-N |
| XLogP | 3.79 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |