C22H22F2N2O2 — CID 177169603
1-[[6-fluoro-4-[(4-fluorophenyl)methoxy]quinolin-2-yl]methyl]piperidin-3-ol (PubChem CID 177169603) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[[6-fluoro-4-[(4-fluorophenyl)methoxy]quinolin-2-yl]methyl]piperidin-3-ol.
| Compound Name | 1-[[6-fluoro-4-[(4-fluorophenyl)methoxy]quinolin-2-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 177169603 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[[6-fluoro-4-[(4-fluorophenyl)methoxy]quinolin-2-yl]methyl]piperidin-3-ol |
| SMILES | OC1CCCN(Cc2cc(OCc3ccc(F)cc3)c3cc(F)ccc3n2)C1 |
| InChI | InChI=1S/C22H22F2N2O2/c23-16-5-3-15(4-6-16)14-28-22-11-18(12-26-9-1-2-19(27)13-26)25-21-8-7-17(24)10-20(21)22/h3-8,10-11,19,27H,1-2,9,12-14H2 |
| InChIKey | SUOMXJQVBVSTEH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |