C22H34O4S4 — CID 177172456
benzylsulfanyl(2-hydroxyethylsulfanyl)methanethione;(4S,7R)-4-methyl-7-propan-2-yloxy-2-sulfanyloctane-3,6-dione (PubChem CID 177172456) has the molecular formula C22H34O4S4 and a molecular weight of 490.78 g/mol. Its IUPAC name is benzylsulfanyl(2-hydroxyethylsulfanyl)methanethione;(4S,7R)-4-methyl-7-propan-2-yloxy-2-sulfanyloctane-3,6-dione.
| Compound Name | benzylsulfanyl(2-hydroxyethylsulfanyl)methanethione;(4S,7R)-4-methyl-7-propan-2-yloxy-2-sulfanyloctane-3,6-dione |
|---|---|
| PubChem CID | 177172456 |
| Molecular Formula | C22H34O4S4 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | benzylsulfanyl(2-hydroxyethylsulfanyl)methanethione;(4S,7R)-4-methyl-7-propan-2-yloxy-2-sulfanyloctane-3,6-dione |
| SMILES | CC(C)O[C@H](C)C(=O)C[C@H](C)C(=O)C(C)S.OCCSC(=S)SCc1ccccc1 |
| InChI | InChI=1S/C12H22O3S.C10H12OS3/c1-7(2)15-9(4)11(13)6-8(3)12(14)10(5)16;11-6-7-13-10(12)14-8-9-4-2-1-3-5-9/h7-10,16H,6H2,1-5H3;1-5,11H,6-8H2/t8-,9+,10?;/m0./s1 |
| InChIKey | DNBLZNRUVDFWBD-BXEJEDLJSA-N |
| XLogP | 5.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|