C29H38N4 — CID 177174140
2-[4-(azetidin-3-ylmethyl)phenyl]-7-ethyl-4-pyrrolidin-1-ylquinoline;N-ethenylethanamine (PubChem CID 177174140) has the molecular formula C29H38N4 and a molecular weight of 442.65 g/mol. Its IUPAC name is 2-[4-(azetidin-3-ylmethyl)phenyl]-7-ethyl-4-pyrrolidin-1-ylquinoline;N-ethenylethanamine.
| Compound Name | 2-[4-(azetidin-3-ylmethyl)phenyl]-7-ethyl-4-pyrrolidin-1-ylquinoline;N-ethenylethanamine |
|---|---|
| PubChem CID | 177174140 |
| Molecular Formula | C29H38N4 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 2-[4-(azetidin-3-ylmethyl)phenyl]-7-ethyl-4-pyrrolidin-1-ylquinoline;N-ethenylethanamine |
| SMILES | C=CNCC.CCc1ccc2c(N3CCCC3)cc(-c3ccc(CC4CNC4)cc3)nc2c1 |
| InChI | InChI=1S/C25H29N3.C4H9N/c1-2-18-7-10-22-24(14-18)27-23(15-25(22)28-11-3-4-12-28)21-8-5-19(6-9-21)13-20-16-26-17-20;1-3-5-4-2/h5-10,14-15,20,26H,2-4,11-13,16-17H2,1H3;3,5H,1,4H2,2H3 |
| InChIKey | GOVZCWGOXHCEHC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |