C31H41FN4 — CID 177173783
3-[4-[4-(3a-fluoro-4-methylidene-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl)-7-ethylquinolin-2-yl]phenyl]-N-methylpropan-1-amine;ethane (PubChem CID 177173783) has the molecular formula C31H41FN4 and a molecular weight of 488.70 g/mol. Its IUPAC name is 3-[4-[4-(3a-fluoro-4-methylidene-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl)-7-ethylquinolin-2-yl]phenyl]-N-methylpropan-1-amine;ethane.
| Compound Name | 3-[4-[4-(3a-fluoro-4-methylidene-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl)-7-ethylquinolin-2-yl]phenyl]-N-methylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 177173783 |
| Molecular Formula | C31H41FN4 |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | 3-[4-[4-(3a-fluoro-4-methylidene-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl)-7-ethylquinolin-2-yl]phenyl]-N-methylpropan-1-amine;ethane |
| SMILES | C=C1NCCC2CN(c3cc(-c4ccc(CCCNC)cc4)nc4cc(CC)ccc34)CC12F.CC |
| InChI | InChI=1S/C29H35FN4.C2H6/c1-4-21-9-12-25-27(16-21)33-26(23-10-7-22(8-11-23)6-5-14-31-3)17-28(25)34-18-24-13-15-32-20(2)29(24,30)19-34;1-2/h7-12,16-17,24,31-32H,2,4-6,13-15,18-19H2,1,3H3;1-2H3 |
| InChIKey | YEFUJTTYIARLSO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|