C33H48N4 — CID 177173845
N-(cyclopropylmethyl)-7-ethyl-2-[4-[3-(pentylamino)propyl]phenyl]quinolin-4-amine;N-methylprop-1-en-2-amine (PubChem CID 177173845) has the molecular formula C33H48N4 and a molecular weight of 500.78 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-7-ethyl-2-[4-[3-(pentylamino)propyl]phenyl]quinolin-4-amine;N-methylprop-1-en-2-amine.
| Compound Name | N-(cyclopropylmethyl)-7-ethyl-2-[4-[3-(pentylamino)propyl]phenyl]quinolin-4-amine;N-methylprop-1-en-2-amine |
|---|---|
| PubChem CID | 177173845 |
| Molecular Formula | C33H48N4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | N-(cyclopropylmethyl)-7-ethyl-2-[4-[3-(pentylamino)propyl]phenyl]quinolin-4-amine;N-methylprop-1-en-2-amine |
| SMILES | C=C(C)NC.CCCCCNCCCc1ccc(-c2cc(NCC3CC3)c3ccc(CC)cc3n2)cc1 |
| InChI | InChI=1S/C29H39N3.C4H9N/c1-3-5-6-17-30-18-7-8-23-11-14-25(15-12-23)27-20-28(31-21-24-9-10-24)26-16-13-22(4-2)19-29(26)32-27;1-4(2)5-3/h11-16,19-20,24,30H,3-10,17-18,21H2,1-2H3,(H,31,32);5H,1H2,2-3H3 |
| InChIKey | WAFCIJQKJKXQPQ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|