C21H42N4O4 — CID 177174947
N-[1-[(1,6-diamino-1-oxohexan-2-yl)amino]-1-oxopentan-2-yl]-10-hydroxydecanamide (PubChem CID 177174947) has the molecular formula C21H42N4O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-[1-[(1,6-diamino-1-oxohexan-2-yl)amino]-1-oxopentan-2-yl]-10-hydroxydecanamide.
| Compound Name | N-[1-[(1,6-diamino-1-oxohexan-2-yl)amino]-1-oxopentan-2-yl]-10-hydroxydecanamide |
|---|---|
| PubChem CID | 177174947 |
| Molecular Formula | C21H42N4O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | N-[1-[(1,6-diamino-1-oxohexan-2-yl)amino]-1-oxopentan-2-yl]-10-hydroxydecanamide |
| SMILES | CCCC(NC(=O)CCCCCCCCCO)C(=O)NC(CCCCN)C(N)=O |
| InChI | InChI=1S/C21H42N4O4/c1-2-12-18(21(29)25-17(20(23)28)13-9-10-15-22)24-19(27)14-8-6-4-3-5-7-11-16-26/h17-18,26H,2-16,22H2,1H3,(H2,23,28)(H,24,27)(H,25,29) |
| InChIKey | UXSBRTBZOQFKCN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|