C27H27N5O4 — CID 177175077
3-[2-[4-hydroxy-1-(quinolin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione (PubChem CID 177175077) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is 3-[2-[4-hydroxy-1-(quinolin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[4-hydroxy-1-(quinolin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177175077 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 3-[2-[4-hydroxy-1-(quinolin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3nc(C4(O)CCN(Cc5cnc6ccccc6c5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H27N5O4/c33-24-8-6-22(25(34)30-24)32-16-21-19(26(32)35)5-7-23(29-21)27(36)9-11-31(12-10-27)15-17-13-18-3-1-2-4-20(18)28-14-17/h1-5,7,13-14,22,36H,6,8-12,15-16H2,(H,30,33,34) |
| InChIKey | ZKVXBGHDGAPKEA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|