C25H30N6O4 — CID 177175130
3-[2-[4-hydroxy-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione (PubChem CID 177175130) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-[2-[4-hydroxy-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[4-hydroxy-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177175130 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 3-[2-[4-hydroxy-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethyl)piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3nc(C4(O)CCN(Cc5cnn6c5CCCC6)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H30N6O4/c32-22-7-5-20(23(33)28-22)30-15-18-17(24(30)34)4-6-21(27-18)25(35)8-11-29(12-9-25)14-16-13-26-31-10-2-1-3-19(16)31/h4,6,13,20,35H,1-3,5,7-12,14-15H2,(H,28,32,33) |
| InChIKey | ZKRRRLSPCPGSLM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|