C15H22Br2O3Si — CID 177175663
methyl 3,5-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-6-methylbenzoate (PubChem CID 177175663) has the molecular formula C15H22Br2O3Si and a molecular weight of 438.23 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-6-methylbenzoate.
| Compound Name | methyl 3,5-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-6-methylbenzoate |
|---|---|
| PubChem CID | 177175663 |
| Molecular Formula | C15H22Br2O3Si |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | methyl 3,5-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-6-methylbenzoate |
| SMILES | COC(=O)c1c(C)c(Br)cc(Br)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H22Br2O3Si/c1-9-10(16)8-11(17)13(12(9)14(18)19-5)20-21(6,7)15(2,3)4/h8H,1-7H3 |
| InChIKey | ABMSYPZWWMNOHK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|