C17H12F4N2O3 — CID 177175945
2-(difluoromethoxy)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]benzaldehyde (PubChem CID 177175945) has the molecular formula C17H12F4N2O3 and a molecular weight of 368.29 g/mol. Its IUPAC name is 2-(difluoromethoxy)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]benzaldehyde.
| Compound Name | 2-(difluoromethoxy)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 177175945 |
| Molecular Formula | C17H12F4N2O3 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(difluoromethoxy)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]benzaldehyde |
| SMILES | O=Cc1ccc(N2CCN(c3ccc(F)cc3F)C2=O)cc1OC(F)F |
| InChI | InChI=1S/C17H12F4N2O3/c18-11-2-4-14(13(19)7-11)23-6-5-22(17(23)25)12-3-1-10(9-24)15(8-12)26-16(20)21/h1-4,7-9,16H,5-6H2 |
| InChIKey | BEWZLYAVJXJWKC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|