C23H28N4O4 — CID 177176521
5-[4-[3-(3-ethylmorpholin-4-yl)propoxy]phenoxy]imidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 177176521) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 5-[4-[3-(3-ethylmorpholin-4-yl)propoxy]phenoxy]imidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | 5-[4-[3-(3-ethylmorpholin-4-yl)propoxy]phenoxy]imidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 177176521 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-[4-[3-(3-ethylmorpholin-4-yl)propoxy]phenoxy]imidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | CCC1COCCN1CCCOc1ccc(Oc2cc(C(N)=O)cc3cncn23)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-2-18-15-29-11-9-26(18)8-3-10-30-20-4-6-21(7-5-20)31-22-13-17(23(24)28)12-19-14-25-16-27(19)22/h4-7,12-14,16,18H,2-3,8-11,15H2,1H3,(H2,24,28) |
| InChIKey | UDVYHQKUMDFIAG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|