C18H31NO3 — CID 177182677
3-acetyl-4-(2-methylpropyl)-2-non-3-enyl-1,3-oxazolidin-5-one (PubChem CID 177182677) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-acetyl-4-(2-methylpropyl)-2-non-3-enyl-1,3-oxazolidin-5-one.
| Compound Name | 3-acetyl-4-(2-methylpropyl)-2-non-3-enyl-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 177182677 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 3-acetyl-4-(2-methylpropyl)-2-non-3-enyl-1,3-oxazolidin-5-one |
| SMILES | CCCCCC=CCCC1OC(=O)C(CC(C)C)N1C(C)=O |
| InChI | InChI=1S/C18H31NO3/c1-5-6-7-8-9-10-11-12-17-19(15(4)20)16(13-14(2)3)18(21)22-17/h9-10,14,16-17H,5-8,11-13H2,1-4H3 |
| InChIKey | VFTNQLNSPCMQDM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|