C11H21F3N2 — CID 177183491
ethane;N-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-amine (PubChem CID 177183491) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is ethane;N-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-amine.
| Compound Name | ethane;N-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-amine |
|---|---|
| PubChem CID | 177183491 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | ethane;N-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-amine |
| SMILES | CC.CNC1CC=CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2.C2H6/c1-13-8-4-2-3-5-14(6-8)7-9(10,11)12;1-2/h2-3,8,13H,4-7H2,1H3;1-2H3 |
| InChIKey | CXGKUBGFYZRWIR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|