C24H27N5O4 — CID 177183533
(1,3-dioxo-7-pyridin-3-yl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl) 4-benzylpiperidine-1-carboxylate (PubChem CID 177183533) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is (1,3-dioxo-7-pyridin-3-yl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl) 4-benzylpiperidine-1-carboxylate.
| Compound Name | (1,3-dioxo-7-pyridin-3-yl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl) 4-benzylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177183533 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (1,3-dioxo-7-pyridin-3-yl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl) 4-benzylpiperidine-1-carboxylate |
| SMILES | O=C(ON1C(=O)C2CN(c3cccnc3)CCN2C1=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N5O4/c30-22-21-17-27(20-7-4-10-25-16-20)13-14-28(21)23(31)29(22)33-24(32)26-11-8-19(9-12-26)15-18-5-2-1-3-6-18/h1-7,10,16,19,21H,8-9,11-15,17H2 |
| InChIKey | BXLLLINZSNEXQB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|