C17H26FN3 — CID 177186290
ethane;4-ethenyl-2-(2-fluoro-2-methyl-6-azaspiro[3.4]octan-6-yl)pyridin-3-amine (PubChem CID 177186290) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is ethane;4-ethenyl-2-(2-fluoro-2-methyl-6-azaspiro[3.4]octan-6-yl)pyridin-3-amine.
| Compound Name | ethane;4-ethenyl-2-(2-fluoro-2-methyl-6-azaspiro[3.4]octan-6-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 177186290 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | ethane;4-ethenyl-2-(2-fluoro-2-methyl-6-azaspiro[3.4]octan-6-yl)pyridin-3-amine |
| SMILES | C=Cc1ccnc(N2CCC3(C2)CC(C)(F)C3)c1N.CC |
| InChI | InChI=1S/C15H20FN3.C2H6/c1-3-11-4-6-18-13(12(11)17)19-7-5-15(10-19)8-14(2,16)9-15;1-2/h3-4,6H,1,5,7-10,17H2,2H3;1-2H3 |
| InChIKey | UPXXIXQFWKQCEZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |