C7H13NO2 — CID 177187358
(1R,5S)-3-ethyl-6,8-dioxa-3-azabicyclo[3.2.1]octane (PubChem CID 177187358) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (1R,5S)-3-ethyl-6,8-dioxa-3-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-ethyl-6,8-dioxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 177187358 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (1R,5S)-3-ethyl-6,8-dioxa-3-azabicyclo[3.2.1]octane |
| SMILES | CCN1C[C@@H]2CO[C@H](C1)O2 |
| InChI | InChI=1S/C7H13NO2/c1-2-8-3-6-5-9-7(4-8)10-6/h6-7H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | YONCTFJVCOCYSA-RQJHMYQMSA-N |
| XLogP | 0.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |