C11H25N — CID 177188289
3,3-diethyl-1-methylpyrrolidine;ethane (PubChem CID 177188289) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is 3,3-diethyl-1-methylpyrrolidine;ethane.
| Compound Name | 3,3-diethyl-1-methylpyrrolidine;ethane |
|---|---|
| PubChem CID | 177188289 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | 3,3-diethyl-1-methylpyrrolidine;ethane |
| SMILES | CC.CCC1(CC)CCN(C)C1 |
| InChI | InChI=1S/C9H19N.C2H6/c1-4-9(5-2)6-7-10(3)8-9;1-2/h4-8H2,1-3H3;1-2H3 |
| InChIKey | FIWBVTVOXAOWAQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |