C24H24N4O — CID 177189609
ethane;(4S)-8-ethynyl-4-methyl-6-(2-methylphenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide (PubChem CID 177189609) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is ethane;(4S)-8-ethynyl-4-methyl-6-(2-methylphenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide.
| Compound Name | ethane;(4S)-8-ethynyl-4-methyl-6-(2-methylphenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 177189609 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | ethane;(4S)-8-ethynyl-4-methyl-6-(2-methylphenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1C)=N[C@@H](C)c1c(C(N)=O)ncn1-2.CC |
| InChI | InChI=1S/C22H18N4O.C2H6/c1-4-15-9-10-18-17(11-15)19(16-8-6-5-7-13(16)2)25-14(3)21-20(22(23)27)24-12-26(18)21;1-2/h1,5-12,14H,2-3H3,(H2,23,27);1-2H3/t14-;/m0./s1 |
| InChIKey | XGMXARUUKLZLJX-UQKRIMTDSA-N |
| XLogP | 4.20 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|