C25H19ClF3N3O2 — CID 177192178
(2R)-2-(2-chloro-3,4-difluorophenyl)-6-fluoro-1,2,3,4-tetrahydronaphthalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 177192178) has the molecular formula C25H19ClF3N3O2 and a molecular weight of 485.89 g/mol. Its IUPAC name is (2R)-2-(2-chloro-3,4-difluorophenyl)-6-fluoro-1,2,3,4-tetrahydronaphthalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | (2R)-2-(2-chloro-3,4-difluorophenyl)-6-fluoro-1,2,3,4-tetrahydronaphthalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 177192178 |
| Molecular Formula | C25H19ClF3N3O2 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (2R)-2-(2-chloro-3,4-difluorophenyl)-6-fluoro-1,2,3,4-tetrahydronaphthalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | Fc1ccc2c(c1)CC[C@@H](c1ccc(F)c(F)c1Cl)C2.NC(=O)c1nccc2[nH]ccc(=O)c12 |
| InChI | InChI=1S/C16H12ClF3.C9H7N3O2/c17-15-13(5-6-14(19)16(15)20)11-2-1-10-8-12(18)4-3-9(10)7-11;10-9(14)8-7-5(1-3-12-8)11-4-2-6(7)13/h3-6,8,11H,1-2,7H2;1-4H,(H2,10,14)(H,11,13)/t11-;/m1./s1 |
| InChIKey | YYYVLCJWHHNLSJ-RFVHGSKJSA-N |
| XLogP | 5.05 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|