C24H23ClF3N3O2 — CID 178085724
(3aR,6aS)-3-(3-chloro-4-fluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 178085724) has the molecular formula C24H23ClF3N3O2 and a molecular weight of 477.91 g/mol. Its IUPAC name is (3aR,6aS)-3-(3-chloro-4-fluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | (3aR,6aS)-3-(3-chloro-4-fluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 178085724 |
| Molecular Formula | C24H23ClF3N3O2 |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | (3aR,6aS)-3-(3-chloro-4-fluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene;4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | Cc1c(C2CC[C@H]3[C@@H]2CCC3(F)F)ccc(F)c1Cl.NC(=O)c1nccc2[nH]ccc(=O)c12 |
| InChI | InChI=1S/C15H16ClF3.C9H7N3O2/c1-8-9(3-5-13(17)14(8)16)10-2-4-12-11(10)6-7-15(12,18)19;10-9(14)8-7-5(1-3-12-8)11-4-2-6(7)13/h3,5,10-12H,2,4,6-7H2,1H3;1-4H,(H2,10,14)(H,11,13)/t10?,11-,12+;/m1./s1 |
| InChIKey | NBSAVXOTOSXVRB-TZUZVIBKSA-N |
| XLogP | 5.35 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |