C15H16ClF3 — CID 178085552
(3aR,6aS)-3-(2-chloro-4-fluoro-3-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene (PubChem CID 178085552) has the molecular formula C15H16ClF3 and a molecular weight of 288.74 g/mol. Its IUPAC name is (3aR,6aS)-3-(2-chloro-4-fluoro-3-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene.
| Compound Name | (3aR,6aS)-3-(2-chloro-4-fluoro-3-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 178085552 |
| Molecular Formula | C15H16ClF3 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (3aR,6aS)-3-(2-chloro-4-fluoro-3-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
| SMILES | Cc1c(F)ccc(C2CC[C@H]3[C@@H]2CCC3(F)F)c1Cl |
| InChI | InChI=1S/C15H16ClF3/c1-8-13(17)5-3-11(14(8)16)9-2-4-12-10(9)6-7-15(12,18)19/h3,5,9-10,12H,2,4,6-7H2,1H3/t9?,10-,12+/m1/s1 |
| InChIKey | IAGYVMJFDVYZML-YWTFCRFGSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |