C25H23F4N3O2 — CID 178085545
2-[(2R,3R,3aS,6aR)-3-(3,4-difluoro-2,5-dimethylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 178085545) has the molecular formula C25H23F4N3O2 and a molecular weight of 473.47 g/mol. Its IUPAC name is 2-[(2R,3R,3aS,6aR)-3-(3,4-difluoro-2,5-dimethylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[(2R,3R,3aS,6aR)-3-(3,4-difluoro-2,5-dimethylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 178085545 |
| Molecular Formula | C25H23F4N3O2 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[(2R,3R,3aS,6aR)-3-(3,4-difluoro-2,5-dimethylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | Cc1cc([C@@H]2[C@@H]3CCC(F)(F)[C@@H]3C[C@H]2c2cc(=O)c3c(C(N)=O)nccc3[nH]2)c(C)c(F)c1F |
| InChI | InChI=1S/C25H23F4N3O2/c1-10-7-13(11(2)22(27)21(10)26)19-12-3-5-25(28,29)15(12)8-14(19)17-9-18(33)20-16(32-17)4-6-31-23(20)24(30)34/h4,6-7,9,12,14-15,19H,3,5,8H2,1-2H3,(H2,30,34)(H,32,33)/t12-,14+,15-,19+/m1/s1 |
| InChIKey | GZGMESVOKHFPJB-JUIVLLAYSA-N |
| XLogP | 4.85 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |