C14H26N3P — CID 177197146
N'-dipropylphosphanyl-N-(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 177197146) has the molecular formula C14H26N3P and a molecular weight of 267.36 g/mol. Its IUPAC name is N'-dipropylphosphanyl-N-(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-dipropylphosphanyl-N-(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 177197146 |
| Molecular Formula | C14H26N3P |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N'-dipropylphosphanyl-N-(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CCCP(CCC)NCCNCc1ccccn1 |
| InChI | InChI=1S/C14H26N3P/c1-3-11-18(12-4-2)17-10-9-15-13-14-7-5-6-8-16-14/h5-8,15,17H,3-4,9-13H2,1-2H3 |
| InChIKey | SGLJNQTWNHLYDK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|