C41H39N9O5 — CID 177197682
2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]ethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 177197682) has the molecular formula C41H39N9O5 and a molecular weight of 737.82 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]ethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177197682 |
| Molecular Formula | C41H39N9O5 |
| Molecular Weight | 737.82 g/mol |
| Exact Mass | 737.31 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | Cc1c(-c2ccc3cnc(Nc4ccc(CCN5CCN(c6ccc7c(c6)C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)cc4)nc3c2)cnc2c1NCCO2 |
| InChI | InChI=1S/C41H39N9O5/c1-24-32(23-43-38-36(24)42-13-19-55-38)26-4-5-27-22-44-41(46-33(27)20-26)45-28-6-2-25(3-7-28)12-14-48-15-17-49(18-16-48)29-8-9-30-31(21-29)40(54)50(39(30)53)34-10-11-35(51)47-37(34)52/h2-9,20-23,34,42H,10-19H2,1H3,(H,44,45,46)(H,47,51,52) |
| InChIKey | XCHJWFULGHITQW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|