C43H46N8O3 — CID 177197695
3-[4-[4-[1-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 177197695) has the molecular formula C43H46N8O3 and a molecular weight of 722.89 g/mol. Its IUPAC name is 3-[4-[4-[1-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[1-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177197695 |
| Molecular Formula | C43H46N8O3 |
| Molecular Weight | 722.89 g/mol |
| Exact Mass | 722.37 |
| IUPAC Name | 3-[4-[4-[1-[4-[[7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazolin-2-yl]amino]phenyl]piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccc3cnc(Nc4ccc(N5CCC(C6CCN(c7ccc(C8CCC(=O)NC8=O)cc7)CC6)CC5)cc4)nc3c2)cnc2c1NCCO2 |
| InChI | InChI=1S/C43H46N8O3/c1-27-37(26-45-42-40(27)44-18-23-54-42)31-2-3-32-25-46-43(48-38(32)24-31)47-33-6-10-35(11-7-33)51-21-16-29(17-22-51)28-14-19-50(20-15-28)34-8-4-30(5-9-34)36-12-13-39(52)49-41(36)53/h2-11,24-26,28-29,36,44H,12-23H2,1H3,(H,46,47,48)(H,49,52,53) |
| InChIKey | LQPITKOTUBXDGC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.89 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|