C17H22N4O6S — CID 177198914
ethyl 5-(6-methyl-2-nitrocyclohexa-2,4-dien-1-yl)sulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate (PubChem CID 177198914) has the molecular formula C17H22N4O6S and a molecular weight of 410.45 g/mol. Its IUPAC name is ethyl 5-(6-methyl-2-nitrocyclohexa-2,4-dien-1-yl)sulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate.
| Compound Name | ethyl 5-(6-methyl-2-nitrocyclohexa-2,4-dien-1-yl)sulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate |
|---|---|
| PubChem CID | 177198914 |
| Molecular Formula | C17H22N4O6S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl 5-(6-methyl-2-nitrocyclohexa-2,4-dien-1-yl)sulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(n1)CCCN(S(=O)(=O)C1C([N+](=O)[O-])=CC=CC1C)C2 |
| InChI | InChI=1S/C17H22N4O6S/c1-3-27-17(22)14-10-13-11-19(8-5-9-20(13)18-14)28(25,26)16-12(2)6-4-7-15(16)21(23)24/h4,6-7,10,12,16H,3,5,8-9,11H2,1-2H3 |
| InChIKey | AFQAEQUIYOSYFA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 124.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|