C10H13F2N3O — CID 177199659
1-[1-[3-(difluoromethyl)-1-bicyclo[1.1.1]pentanyl]triazol-4-yl]ethanol (PubChem CID 177199659) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-[1-[3-(difluoromethyl)-1-bicyclo[1.1.1]pentanyl]triazol-4-yl]ethanol.
| Compound Name | 1-[1-[3-(difluoromethyl)-1-bicyclo[1.1.1]pentanyl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 177199659 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-[1-[3-(difluoromethyl)-1-bicyclo[1.1.1]pentanyl]triazol-4-yl]ethanol |
| SMILES | CC(O)c1cn(C23CC(C(F)F)(C2)C3)nn1 |
| InChI | InChI=1S/C10H13F2N3O/c1-6(16)7-2-15(14-13-7)10-3-9(4-10,5-10)8(11)12/h2,6,8,16H,3-5H2,1H3 |
| InChIKey | AKNJKZSXTOFSRR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |