C19H26FN5O2 — CID 177203260
2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-piperidin-1-yl-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 177203260) has the molecular formula C19H26FN5O2 and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-piperidin-1-yl-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-piperidin-1-yl-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 177203260 |
| Molecular Formula | C19H26FN5O2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-piperidin-1-yl-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | O=C1NCc2nc(OCC34CCCN3C[C@H](F)C4)nc(N3CCCCC3)c21 |
| InChI | InChI=1S/C19H26FN5O2/c20-13-9-19(5-4-8-25(19)11-13)12-27-18-22-14-10-21-17(26)15(14)16(23-18)24-6-2-1-3-7-24/h13H,1-12H2,(H,21,26)/t13-,19?/m1/s1 |
| InChIKey | WPQNFPKMADNZBN-BSOCMFCZSA-N |
| XLogP | 1.67 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |