C14H17FN4O2 — CID 171650640
2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 171650640) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 171650640 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | O=C1NCc2nc(OC[C@@]34CCCN3C[C@H](F)C4)ncc21 |
| InChI | InChI=1S/C14H17FN4O2/c15-9-4-14(2-1-3-19(14)7-9)8-21-13-17-5-10-11(18-13)6-16-12(10)20/h5,9H,1-4,6-8H2,(H,16,20)/t9-,14+/m1/s1 |
| InChIKey | NVSXYWXSIAUSSE-OTYXRUKQSA-N |
| XLogP | 0.68 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |