About 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene
4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene (PubChem CID 177204961) has the molecular formula C16H24F3NO2
and a molecular weight of 319.37 g/mol. Its IUPAC name is 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene |
| PubChem CID | 177204961 |
| Molecular Formula | C16H24F3NO2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene |
| SMILES | CCC(C)N1CCOCC1.COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3O.C8H17NO/c1-12-7-4-2-3-6(5-7)8(9,10)11;1-3-8(2)9-4-6-10-7-5-9/h2-5H,1H3;8H,3-7H2,1-2H3 |
| InChIKey | IIBQRVNTPMJXJE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene?
The IUPAC name of 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene (CID 177204961) is 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene.
What is the SMILES notation for 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene?
The canonical SMILES for 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene is CCC(C)N1CCOCC1.COc1cccc(C(F)(F)F)c1.
What is the InChIKey of 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene?
The InChIKey is IIBQRVNTPMJXJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O.C8H17NO/c1-12-7-4-2-3-6(5-7)8(9,10)11;1-3-8(2)9-4-6-10-7-5-9/h2-5H,1H3;8H,3-7H2,1-2H3.
What are the key properties of 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene?
4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene has a molecular weight of 319.37 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-ylmorpholine;1-methoxy-3-(trifluoromethyl)benzene is sourced from PubChem (CID 177204961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).