C23H28F2N4O5 — CID 177205271
[(5R,12S)-7-amino-5-methyl-4,11-dioxa-8-azatricyclo[7.4.0.02,6]trideca-1,6,8-trien-12-yl]-piperidin-1-ylmethanone;6-(difluoromethoxy)-1H-pyridin-2-one (PubChem CID 177205271) has the molecular formula C23H28F2N4O5 and a molecular weight of 478.50 g/mol. Its IUPAC name is [(5R,12S)-7-amino-5-methyl-4,11-dioxa-8-azatricyclo[7.4.0.02,6]trideca-1,6,8-trien-12-yl]-piperidin-1-ylmethanone;6-(difluoromethoxy)-1H-pyridin-2-one.
| Compound Name | [(5R,12S)-7-amino-5-methyl-4,11-dioxa-8-azatricyclo[7.4.0.02,6]trideca-1,6,8-trien-12-yl]-piperidin-1-ylmethanone;6-(difluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 177205271 |
| Molecular Formula | C23H28F2N4O5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(5R,12S)-7-amino-5-methyl-4,11-dioxa-8-azatricyclo[7.4.0.02,6]trideca-1,6,8-trien-12-yl]-piperidin-1-ylmethanone;6-(difluoromethoxy)-1H-pyridin-2-one |
| SMILES | C[C@H]1OCc2c3c(nc(N)c21)CO[C@H](C(=O)N1CCCCC1)C3.O=c1cccc(OC(F)F)[nH]1 |
| InChI | InChI=1S/C17H23N3O3.C6H5F2NO2/c1-10-15-12(8-22-10)11-7-14(23-9-13(11)19-16(15)18)17(21)20-5-3-2-4-6-20;7-6(8)11-5-3-1-2-4(10)9-5/h10,14H,2-9H2,1H3,(H2,18,19);1-3,6H,(H,9,10)/t10-,14+;/m1./s1 |
| InChIKey | RBEDHMVOMPUNHJ-LOSLGVLSSA-N |
| XLogP | 2.69 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |