C13H17F2NO2 — CID 177205822
1,2-difluoro-3-methoxybenzene;5-methylpiperidin-3-one (PubChem CID 177205822) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 1,2-difluoro-3-methoxybenzene;5-methylpiperidin-3-one.
| Compound Name | 1,2-difluoro-3-methoxybenzene;5-methylpiperidin-3-one |
|---|---|
| PubChem CID | 177205822 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1,2-difluoro-3-methoxybenzene;5-methylpiperidin-3-one |
| SMILES | CC1CNCC(=O)C1.COc1cccc(F)c1F |
| InChI | InChI=1S/C7H6F2O.C6H11NO/c1-10-6-4-2-3-5(8)7(6)9;1-5-2-6(8)4-7-3-5/h2-4H,1H3;5,7H,2-4H2,1H3 |
| InChIKey | XGWIHADDLPTSJI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |