C14H20F2O4 — CID 171794666
acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane (PubChem CID 171794666) has the molecular formula C14H20F2O4 and a molecular weight of 290.31 g/mol. Its IUPAC name is acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane.
| Compound Name | acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane |
|---|---|
| PubChem CID | 171794666 |
| Molecular Formula | C14H20F2O4 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane |
| SMILES | CC(=O)O.CC1CCCO1.COc1cccc(F)c1F |
| InChI | InChI=1S/C7H6F2O.C5H10O.C2H4O2/c1-10-6-4-2-3-5(8)7(6)9;1-5-3-2-4-6-5;1-2(3)4/h2-4H,1H3;5H,2-4H2,1H3;1H3,(H,3,4) |
| InChIKey | MDRVEQWLANIOCC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |