acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane

C14H20F2O4 — CID 171794666

IUPACacetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane
SMILESCC(=O)O.CC1CCCO1.COc1cccc(F)c1F
InChIInChI=1S/C7H6F2O.C5H10O.C2H4O2/c1-10-6-4-2-3-5(8)7(6)9;1-5-3-2-4-6-5;1-2(3)4/h2-4H,1H3;5H,2-4H2,1H3;1H3,(H,3,4)
InChIKeyMDRVEQWLANIOCC-UHFFFAOYSA-N
MW290.31 g/mol
LogP3.25
Rot. Bonds1

About acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane

acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane (PubChem CID 171794666) has the molecular formula C14H20F2O4 and a molecular weight of 290.31 g/mol. Its IUPAC name is acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane.

Molecular Properties

Compound Nameacetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane
PubChem CID171794666
Molecular FormulaC14H20F2O4
Molecular Weight290.31 g/mol
Exact Mass290.13
IUPAC Nameacetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane
SMILESCC(=O)O.CC1CCCO1.COc1cccc(F)c1F
InChIInChI=1S/C7H6F2O.C5H10O.C2H4O2/c1-10-6-4-2-3-5(8)7(6)9;1-5-3-2-4-6-5;1-2(3)4/h2-4H,1H3;5H,2-4H2,1H3;1H3,(H,3,4)
InChIKeyMDRVEQWLANIOCC-UHFFFAOYSA-N
XLogP3.25
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.31
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane?
The IUPAC name of acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane (CID 171794666) is acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane.
What is the SMILES notation for acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane?
The canonical SMILES for acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane is CC(=O)O.CC1CCCO1.COc1cccc(F)c1F.
What is the InChIKey of acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane?
The InChIKey is MDRVEQWLANIOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O.C5H10O.C2H4O2/c1-10-6-4-2-3-5(8)7(6)9;1-5-3-2-4-6-5;1-2(3)4/h2-4H,1H3;5H,2-4H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane?
acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane has a molecular weight of 290.31 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,2-difluoro-3-methoxybenzene;2-methyloxolane is sourced from PubChem (CID 171794666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).