C12H10BrF2NO2 — CID 177206864
methyl 4-bromo-3-(4,4-difluoro-2,3-dihydropyrrol-5-yl)benzoate (PubChem CID 177206864) has the molecular formula C12H10BrF2NO2 and a molecular weight of 318.12 g/mol. Its IUPAC name is methyl 4-bromo-3-(4,4-difluoro-2,3-dihydropyrrol-5-yl)benzoate.
| Compound Name | methyl 4-bromo-3-(4,4-difluoro-2,3-dihydropyrrol-5-yl)benzoate |
|---|---|
| PubChem CID | 177206864 |
| Molecular Formula | C12H10BrF2NO2 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | methyl 4-bromo-3-(4,4-difluoro-2,3-dihydropyrrol-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(Br)c(C2=NCCC2(F)F)c1 |
| InChI | InChI=1S/C12H10BrF2NO2/c1-18-11(17)7-2-3-9(13)8(6-7)10-12(14,15)4-5-16-10/h2-3,6H,4-5H2,1H3 |
| InChIKey | GKXDVFHJWWOKBC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |