C30H30BBrN2O4 — CID 177209329
CID 177209329 (PubChem CID 177209329) has the molecular formula C30H30BBrN2O4 and a molecular weight of 573.30 g/mol.
| Compound Name | CID 177209329 |
|---|---|
| PubChem CID | 177209329 |
| Molecular Formula | C30H30BBrN2O4 |
| Molecular Weight | 573.30 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | — |
| SMILES | [B]C1C(=O)C2(NC(=O)c3c(C)c(-c4ccccc4)nc4ccc(Br)cc34)CCC1(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C30H30BBrN2O4/c1-17-22(20-16-19(32)10-11-21(20)33-23(17)18-8-6-5-7-9-18)26(36)34-30-14-12-29(13-15-30,24(31)25(30)35)27(37)38-28(2,3)4/h5-11,16,24H,12-15H2,1-4H3,(H,34,36) |
| InChIKey | ZXXITTZMQZCLBH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.30 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|