C15H20IN3OS — CID 177212692
ethane;2-[5-(4-methyl-7-oxo-1,4-diazepan-1-yl)-2-pyridinyl]ethynyl thiohypoiodite (PubChem CID 177212692) has the molecular formula C15H20IN3OS and a molecular weight of 417.32 g/mol. Its IUPAC name is ethane;2-[5-(4-methyl-7-oxo-1,4-diazepan-1-yl)-2-pyridinyl]ethynyl thiohypoiodite.
| Compound Name | ethane;2-[5-(4-methyl-7-oxo-1,4-diazepan-1-yl)-2-pyridinyl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 177212692 |
| Molecular Formula | C15H20IN3OS |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | ethane;2-[5-(4-methyl-7-oxo-1,4-diazepan-1-yl)-2-pyridinyl]ethynyl thiohypoiodite |
| SMILES | CC.CN1CCC(=O)N(c2ccc(C#CSI)nc2)CC1 |
| InChI | InChI=1S/C13H14IN3OS.C2H6/c1-16-6-4-13(18)17(8-7-16)12-3-2-11(15-10-12)5-9-19-14;1-2/h2-3,10H,4,6-8H2,1H3;1-2H3 |
| InChIKey | BHSPDCFGZAOIDC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|