C16H20FNO3 — CID 177212994
methyl (2S,3R,6S,8S)-6-fluoro-2-(hydroxymethyl)-3-phenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 177212994) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl (2S,3R,6S,8S)-6-fluoro-2-(hydroxymethyl)-3-phenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
| Compound Name | methyl (2S,3R,6S,8S)-6-fluoro-2-(hydroxymethyl)-3-phenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 177212994 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl (2S,3R,6S,8S)-6-fluoro-2-(hydroxymethyl)-3-phenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| SMILES | COC(=O)[C@]12C[C@H](F)CN1[C@@H](c1ccccc1)[C@@H](CO)C2 |
| InChI | InChI=1S/C16H20FNO3/c1-21-15(20)16-7-12(10-19)14(11-5-3-2-4-6-11)18(16)9-13(17)8-16/h2-6,12-14,19H,7-10H2,1H3/t12-,13+,14+,16+/m1/s1 |
| InChIKey | FAMOQBTZNRKMFH-HOSILWTGSA-N |
| XLogP | 1.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |