C27H40ClN3O4SSi — CID 177213878
(2S,3S)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetyl]-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methylpiperidine-3-carboxamide (PubChem CID 177213878) has the molecular formula C27H40ClN3O4SSi and a molecular weight of 566.24 g/mol. Its IUPAC name is (2S,3S)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetyl]-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methylpiperidine-3-carboxamide.
| Compound Name | (2S,3S)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetyl]-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 177213878 |
| Molecular Formula | C27H40ClN3O4SSi |
| Molecular Weight | 566.24 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | (2S,3S)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetyl]-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methylpiperidine-3-carboxamide |
| SMILES | C[C@H]1[C@@H](C(=O)NCc2nc(-c3ccc(Cl)cc3)cs2)CCCN1C(=O)COCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H40ClN3O4SSi/c1-19-22(26(33)29-16-24-30-23(18-36-24)20-9-11-21(28)12-10-20)8-7-13-31(19)25(32)17-34-14-15-35-37(5,6)27(2,3)4/h9-12,18-19,22H,7-8,13-17H2,1-6H3,(H,29,33)/t19-,22-/m0/s1 |
| InChIKey | KMIXPONMTJVIAH-UGKGYDQZSA-N |
| XLogP | 5.75 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.24 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|