C19H18FN3O2S2 — CID 177214020
5-fluoro-N-[4-[2-(2-methylsulfanylethoxymethyl)phenyl]-1,3-thiazol-2-yl]pyridine-2-carboxamide (PubChem CID 177214020) has the molecular formula C19H18FN3O2S2 and a molecular weight of 403.50 g/mol. Its IUPAC name is 5-fluoro-N-[4-[2-(2-methylsulfanylethoxymethyl)phenyl]-1,3-thiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-fluoro-N-[4-[2-(2-methylsulfanylethoxymethyl)phenyl]-1,3-thiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177214020 |
| Molecular Formula | C19H18FN3O2S2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 5-fluoro-N-[4-[2-(2-methylsulfanylethoxymethyl)phenyl]-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| SMILES | CSCCOCc1ccccc1-c1csc(NC(=O)c2ccc(F)cn2)n1 |
| InChI | InChI=1S/C19H18FN3O2S2/c1-26-9-8-25-11-13-4-2-3-5-15(13)17-12-27-19(22-17)23-18(24)16-7-6-14(20)10-21-16/h2-7,10,12H,8-9,11H2,1H3,(H,22,23,24) |
| InChIKey | VOQXONCGSILDME-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|